C16H26F3N5OS — CID 111616316
2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616316) has the molecular formula C16H26F3N5OS and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616316 |
| Molecular Formula | C16H26F3N5OS |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1nc(C(F)(F)F)cs1)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C16H26F3N5OS/c1-11(2)8-24-4-5-25-12(9-24)6-21-15(20-3)22-7-14-23-13(10-26-14)16(17,18)19/h10-12H,4-9H2,1-3H3,(H2,20,21,22) |
| InChIKey | ZDTBHVLISAKPFJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|