C13H20O7S — CID 11162991
[(2S,3aR,6R,7S,7aR)-7-acetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] acetate (PubChem CID 11162991) has the molecular formula C13H20O7S and a molecular weight of 320.36 g/mol. Its IUPAC name is [(2S,3aR,6R,7S,7aR)-7-acetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] acetate.
| Compound Name | [(2S,3aR,6R,7S,7aR)-7-acetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] acetate |
|---|---|
| PubChem CID | 11162991 |
| Molecular Formula | C13H20O7S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(2S,3aR,6R,7S,7aR)-7-acetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] acetate |
| SMILES | CCS[C@]1(C)O[C@H]2OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2O1 |
| InChI | InChI=1S/C13H20O7S/c1-5-21-13(4)19-11-10(18-8(3)15)9(17-7(2)14)6-16-12(11)20-13/h9-12H,5-6H2,1-4H3/t9-,10+,11-,12-,13+/m1/s1 |
| InChIKey | LATQCUPSRKOCMC-MLGHIDQZSA-N |
| XLogP | 1.05 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |