C16H29N3O2S2 — CID 111634735
1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111634735) has the molecular formula C16H29N3O2S2 and a molecular weight of 359.56 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111634735 |
| Molecular Formula | C16H29N3O2S2 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C16H29N3O2S2/c1-6-17-15(18-11-14-8-7-13(2)22-14)19-12-16(3,4)9-10-23(5,20)21/h7-8H,6,9-12H2,1-5H3,(H2,17,18,19) |
| InChIKey | WIJXHGBYTSLQSM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|