C22H28N6O — CID 111659038
1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine (PubChem CID 111659038) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine |
|---|---|
| PubChem CID | 111659038 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[2-(3-methylphenyl)propyl]guanidine |
| SMILES | C/N=C(/NCc1nc(-c2ccc(OC)cc2)n[nH]1)NCC(C)c1cccc(C)c1 |
| InChI | InChI=1S/C22H28N6O/c1-15-6-5-7-18(12-15)16(2)13-24-22(23-3)25-14-20-26-21(28-27-20)17-8-10-19(29-4)11-9-17/h5-12,16H,13-14H2,1-4H3,(H2,23,24,25)(H,26,27,28) |
| InChIKey | MEMOCNBVNSXJDA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|