C22H37N7O3 — CID 111660577
1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111660577) has the molecular formula C22H37N7O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111660577 |
| Molecular Formula | C22H37N7O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1cc(C(C)(O)CN/C(=N\Cc2nnc(C)n2C)NCCCN2CCOCC2)c(C)o1 |
| InChI | InChI=1S/C22H37N7O3/c1-16-13-19(17(2)32-16)22(4,30)15-25-21(24-14-20-27-26-18(3)28(20)5)23-7-6-8-29-9-11-31-12-10-29/h13,30H,6-12,14-15H2,1-5H3,(H2,23,24,25) |
| InChIKey | WTCDVDMCWCBOER-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|