C19H32N6O2 — CID 111660979
1-butyl-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111660979) has the molecular formula C19H32N6O2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-butyl-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-butyl-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111660979 |
| Molecular Formula | C19H32N6O2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 1-butyl-3-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCC(C)(O)c1cc(C)oc1C |
| InChI | InChI=1S/C19H32N6O2/c1-7-8-9-20-18(21-11-17-24-23-15(4)25(17)6)22-12-19(5,26)16-10-13(2)27-14(16)3/h10,26H,7-9,11-12H2,1-6H3,(H2,20,21,22) |
| InChIKey | RVAXPHIAZYRDTK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|