C17H26N6O2 — CID 111664349
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-prop-2-enylguanidine (PubChem CID 111664349) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-prop-2-enylguanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111664349 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NCC(C)(O)c1ccc(C)o1 |
| InChI | InChI=1S/C17H26N6O2/c1-6-9-18-16(19-10-15-22-21-13(3)23(15)5)20-11-17(4,24)14-8-7-12(2)25-14/h6-8,24H,1,9-11H2,2-5H3,(H2,18,19,20) |
| InChIKey | BBBOLYRXLVNMMF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|