C22H38O6Si — CID 11166221
(2R)-2-[(1E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methylhexa-1,5-dienyl]-2,3-dihydropyran-6-one (PubChem CID 11166221) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is (2R)-2-[(1E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methylhexa-1,5-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methylhexa-1,5-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11166221 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (2R)-2-[(1E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methylhexa-1,5-dienyl]-2,3-dihydropyran-6-one |
| SMILES | C=C[C@@H](OCOCCOC)[C@](C)(/C=C/[C@H]1CC=CC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O6Si/c1-9-19(26-17-25-16-15-24-6)22(5,28-29(7,8)21(2,3)4)14-13-18-11-10-12-20(23)27-18/h9-10,12-14,18-19H,1,11,15-17H2,2-8H3/b14-13+/t18-,19-,22+/m1/s1 |
| InChIKey | DWHQOIIIXJLDGO-AKBFLFTMSA-N |
| XLogP | 4.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|