C16H32O6Si — CID 54592110
(E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)hex-2-enoic acid (PubChem CID 54592110) has the molecular formula C16H32O6Si and a molecular weight of 348.51 g/mol. Its IUPAC name is (E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)hex-2-enoic acid.
| Compound Name | (E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)hex-2-enoic acid |
|---|---|
| PubChem CID | 54592110 |
| Molecular Formula | C16H32O6Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)hex-2-enoic acid |
| SMILES | COCCOCO[C@@H](C)[C@@H](/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O6Si/c1-13(21-12-20-11-10-19-5)14(8-9-15(17)18)22-23(6,7)16(2,3)4/h8-9,13-14H,10-12H2,1-7H3,(H,17,18)/b9-8+/t13-,14+/m0/s1 |
| InChIKey | FEPOPQHWOLPKMS-NYCDYWJRSA-N |
| XLogP | 3.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|