C21H34O7Si — CID 11430245
(Z)-4-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoxy]-4-oxobut-2-enoic acid (PubChem CID 11430245) has the molecular formula C21H34O7Si and a molecular weight of 426.58 g/mol. Its IUPAC name is (Z)-4-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 11430245 |
| Molecular Formula | C21H34O7Si |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (Z)-4-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienoxy]-4-oxobut-2-enoic acid |
| SMILES | CC1(C)OC[C@H]([C@H](/C=C/C=C/CO[Si](C)(C)C(C)(C)C)OC(=O)/C=C\C(=O)O)O1 |
| InChI | InChI=1S/C21H34O7Si/c1-20(2,3)29(6,7)26-14-10-8-9-11-16(17-15-25-21(4,5)28-17)27-19(24)13-12-18(22)23/h8-13,16-17H,14-15H2,1-7H3,(H,22,23)/b10-8+,11-9+,13-12-/t16-,17+/m0/s1 |
| InChIKey | CDNGGOMSJGRFOP-FERGDAEBSA-N |
| XLogP | 3.82 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|