C25H24F2N6O — CID 11167130
1-(2,5-difluorophenyl)-3-[3-[2-[2-(2-pyrrolidin-1-ylethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea (PubChem CID 11167130) has the molecular formula C25H24F2N6O and a molecular weight of 462.50 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[3-[2-[2-(2-pyrrolidin-1-ylethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[3-[2-[2-(2-pyrrolidin-1-ylethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea |
|---|---|
| PubChem CID | 11167130 |
| Molecular Formula | C25H24F2N6O |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[3-[2-[2-(2-pyrrolidin-1-ylethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea |
| SMILES | O=C(Nc1cccc(C#Cc2cnc(NCCN3CCCC3)nc2)c1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C25H24F2N6O/c26-20-8-9-22(27)23(15-20)32-25(34)31-21-5-3-4-18(14-21)6-7-19-16-29-24(30-17-19)28-10-13-33-11-1-2-12-33/h3-5,8-9,14-17H,1-2,10-13H2,(H,28,29,30)(H2,31,32,34) |
| InChIKey | BXBRTEWRYIGEJP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|