C19H26N4OS — CID 111673826
2-[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]-N-phenylacetamide (PubChem CID 111673826) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 2-[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]-N-phenylacetamide.
| Compound Name | 2-[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111673826 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]-N-phenylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccccc1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C19H26N4OS/c1-3-20-19(21-13-15(2)12-17-10-7-11-25-17)22-14-18(24)23-16-8-5-4-6-9-16/h4-11,15H,3,12-14H2,1-2H3,(H,23,24)(H2,20,21,22) |
| InChIKey | AGARLRQYZZCUQG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|