C16H20ClIN4O3S — CID 111701860
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111701860) has the molecular formula C16H20ClIN4O3S and a molecular weight of 510.79 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111701860 |
| Molecular Formula | C16H20ClIN4O3S |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C16H19ClN4O3S.HI/c1-2-18-16(20-10-13(22)14-7-8-15(17)25-14)19-9-11-5-3-4-6-12(11)21(23)24;/h3-8,13,22H,2,9-10H2,1H3,(H2,18,19,20);1H |
| InChIKey | VIMCILRCERMADM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|