C15H16N2O — CID 11172510
(5E)-1-methyl-5-(pyridin-3-ylmethylidene)-3a,6,7,7a-tetrahydroindol-4-one (PubChem CID 11172510) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (5E)-1-methyl-5-(pyridin-3-ylmethylidene)-3a,6,7,7a-tetrahydroindol-4-one.
| Compound Name | (5E)-1-methyl-5-(pyridin-3-ylmethylidene)-3a,6,7,7a-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 11172510 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (5E)-1-methyl-5-(pyridin-3-ylmethylidene)-3a,6,7,7a-tetrahydroindol-4-one |
| SMILES | CN1C=CC2C(=O)/C(=C/c3cccnc3)CCC21 |
| InChI | InChI=1S/C15H16N2O/c1-17-8-6-13-14(17)5-4-12(15(13)18)9-11-3-2-7-16-10-11/h2-3,6-10,13-14H,4-5H2,1H3/b12-9+ |
| InChIKey | BWFLBRNJPFXHEX-FMIVXFBMSA-N |
| XLogP | 2.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|