C20H20N3O+ — CID 4232808
8-methyl-2,4-bis(pyridin-3-ylmethylidene)-8-azoniabicyclo[3.2.1]octan-3-one (PubChem CID 4232808) has the molecular formula C20H20N3O+ and a molecular weight of 318.40 g/mol. Its IUPAC name is 8-methyl-2,4-bis(pyridin-3-ylmethylidene)-8-azoniabicyclo[3.2.1]octan-3-one.
| Compound Name | 8-methyl-2,4-bis(pyridin-3-ylmethylidene)-8-azoniabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 4232808 |
| Molecular Formula | C20H20N3O+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 8-methyl-2,4-bis(pyridin-3-ylmethylidene)-8-azoniabicyclo[3.2.1]octan-3-one |
| SMILES | C[NH+]1C2CCC1C(=Cc1cccnc1)C(=O)C2=Cc1cccnc1 |
| InChI | InChI=1S/C20H19N3O/c1-23-18-6-7-19(23)17(11-15-5-3-9-22-13-15)20(24)16(18)10-14-4-2-8-21-12-14/h2-5,8-13,18-19H,6-7H2,1H3/p+1 |
| InChIKey | GZYDXLNQYNGTGS-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|