C19H26N4O — CID 111739198
N-ethyl-3,3-dimethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111739198) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3,3-dimethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739198 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-ethyl-3,3-dimethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(-c2ccccc2)on1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C19H26N4O/c1-4-20-18(23-11-10-19(2,3)14-23)21-13-16-12-17(24-22-16)15-8-6-5-7-9-15/h5-9,12H,4,10-11,13-14H2,1-3H3,(H,20,21) |
| InChIKey | PYCOLBCUQRIVTQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|