C18H33N5O3 — CID 111748059
3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111748059) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748059 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCc1nc(C(C)C)no1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C18H33N5O3/c1-14(2)17-21-16(26-22-17)6-5-8-20-18(19-3)23-9-7-15(12-23)13-25-11-10-24-4/h14-15H,5-13H2,1-4H3,(H,19,20) |
| InChIKey | ZDODRFDNINTTKF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|