C13H17N3O2S — CID 111750728
2-ethyl-N-(2-hydroxy-2-thiophen-2-ylpropyl)-1H-imidazole-5-carboxamide (PubChem CID 111750728) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-ethyl-N-(2-hydroxy-2-thiophen-2-ylpropyl)-1H-imidazole-5-carboxamide.
| Compound Name | 2-ethyl-N-(2-hydroxy-2-thiophen-2-ylpropyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 111750728 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-ethyl-N-(2-hydroxy-2-thiophen-2-ylpropyl)-1H-imidazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)NCC(C)(O)c2cccs2)[nH]1 |
| InChI | InChI=1S/C13H17N3O2S/c1-3-11-14-7-9(16-11)12(17)15-8-13(2,18)10-5-4-6-19-10/h4-7,18H,3,8H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | VQYMOXDBDMJHFK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |