C19H28O3S2 — CID 11176119
(2S,3S)-3-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-1-(1,3-dithian-2-yl)butan-2-ol (PubChem CID 11176119) has the molecular formula C19H28O3S2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (2S,3S)-3-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-1-(1,3-dithian-2-yl)butan-2-ol.
| Compound Name | (2S,3S)-3-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-1-(1,3-dithian-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 11176119 |
| Molecular Formula | C19H28O3S2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2S,3S)-3-[(4R,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-1-(1,3-dithian-2-yl)butan-2-ol |
| SMILES | C[C@H]([C@H]1OC(C)(C)O[C@@H]1c1ccccc1)[C@@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C19H28O3S2/c1-13(15(20)12-16-23-10-7-11-24-16)17-18(22-19(2,3)21-17)14-8-5-4-6-9-14/h4-6,8-9,13,15-18,20H,7,10-12H2,1-3H3/t13-,15-,17+,18+/m0/s1 |
| InChIKey | GXEFLQZTKQNESN-OXXUSNJHSA-N |
| XLogP | 4.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |