C15H23F2N3 — CID 111761323
1-butyl-3-[2-(2,4-difluorophenyl)propyl]-2-methylguanidine (PubChem CID 111761323) has the molecular formula C15H23F2N3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-butyl-3-[2-(2,4-difluorophenyl)propyl]-2-methylguanidine.
| Compound Name | 1-butyl-3-[2-(2,4-difluorophenyl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111761323 |
| Molecular Formula | C15H23F2N3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-butyl-3-[2-(2,4-difluorophenyl)propyl]-2-methylguanidine |
| SMILES | CCCCN/C(=N\C)NCC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H23F2N3/c1-4-5-8-19-15(18-3)20-10-11(2)13-7-6-12(16)9-14(13)17/h6-7,9,11H,4-5,8,10H2,1-3H3,(H2,18,19,20) |
| InChIKey | KYQILHSMVBZXMF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|