C16H29N3 — CID 111770684
N-(2-cyclohexylcyclopropyl)-N'-ethylpyrrolidine-1-carboximidamide (PubChem CID 111770684) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N-(2-cyclohexylcyclopropyl)-N'-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N-(2-cyclohexylcyclopropyl)-N'-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111770684 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N-(2-cyclohexylcyclopropyl)-N'-ethylpyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1CC1C1CCCCC1)N1CCCC1 |
| InChI | InChI=1S/C16H29N3/c1-2-17-16(19-10-6-7-11-19)18-15-12-14(15)13-8-4-3-5-9-13/h13-15H,2-12H2,1H3,(H,17,18) |
| InChIKey | BCIJGTXZLNRVIN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|