C14H18ClF3N4O3S — CID 111772370
1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111772370) has the molecular formula C14H18ClF3N4O3S and a molecular weight of 414.84 g/mol. Its IUPAC name is 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111772370 |
| Molecular Formula | C14H18ClF3N4O3S |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCCOc1ncc(C(F)(F)F)cc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18ClF3N4O3S/c1-19-13(22-10-2-5-26(23,24)8-10)20-3-4-25-12-11(15)6-9(7-21-12)14(16,17)18/h6-7,10H,2-5,8H2,1H3,(H2,19,20,22) |
| InChIKey | WIMATNOIUNOACH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|