About N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide
N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111779172) has the molecular formula C12H27IN4O2S
and a molecular weight of 418.35 g/mol. Its IUPAC name is N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide |
| PubChem CID | 111779172 |
| Molecular Formula | C12H27IN4O2S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)N1CCCC1.I |
| InChI | InChI=1S/C12H26N4O2S.HI/c1-5-13-11(16-8-6-7-9-16)14-10-12(2,3)15-19(4,17)18;/h15H,5-10H2,1-4H3,(H,13,14);1H |
| InChIKey | TZPPMAKKJFQULN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide?
The IUPAC name of N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide (CID 111779172) is N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide.
What is the SMILES notation for N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide?
The canonical SMILES for N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide is CCN/C(=N\CC(C)(C)NS(C)(=O)=O)N1CCCC1.I.
What is the InChIKey of N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide?
The InChIKey is TZPPMAKKJFQULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N4O2S.HI/c1-5-13-11(16-8-6-7-9-16)14-10-12(2,3)15-19(4,17)18;/h15H,5-10H2,1-4H3,(H,13,14);1H.
What are the key properties of N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide?
N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide has a molecular weight of 418.35 g/mol, XLogP of 0.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[2-(methanesulfonamido)-2-methylpropyl]pyrrolidine-1-carboximidamide;hydroiodide is sourced from PubChem (CID 111779172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).