C16H22ClN5O — CID 111794356
1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine (PubChem CID 111794356) has the molecular formula C16H22ClN5O and a molecular weight of 335.84 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine.
| Compound Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111794356 |
| Molecular Formula | C16H22ClN5O |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
| SMILES | C/N=C(/NCc1cnn(-c2ccc(Cl)cc2)c1)NC(C)COC |
| InChI | InChI=1S/C16H22ClN5O/c1-12(11-23-3)21-16(18-2)19-8-13-9-20-22(10-13)15-6-4-14(17)5-7-15/h4-7,9-10,12H,8,11H2,1-3H3,(H2,18,19,21) |
| InChIKey | VZTPFNOMMPDJRN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|