C20H20N2O3 — CID 111798653
N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylacetamide (PubChem CID 111798653) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylacetamide.
| Compound Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylacetamide |
|---|---|
| PubChem CID | 111798653 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-spiro[2H-indole-3,1'-cyclopropane]-1-ylacetamide |
| SMILES | O=C(N[C@H](CO)c1ccccc1)C(=O)N1CC2(CC2)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O3/c23-12-16(14-6-2-1-3-7-14)21-18(24)19(25)22-13-20(10-11-20)15-8-4-5-9-17(15)22/h1-9,16,23H,10-13H2,(H,21,24)/t16-/m1/s1 |
| InChIKey | NQANERJIZYZCSO-MRXNPFEDSA-N |
| XLogP | 1.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|