C32H56O8Si — CID 11180919
[(2S,3S,4S,6R)-2,4-dimethoxy-6-[(2S,3S)-2-methoxy-3-(methoxymethoxy)pent-4-enyl]-2-(2-methyl-1-phenylmethoxypropan-2-yl)oxan-3-yl]oxy-triethylsilane (PubChem CID 11180919) has the molecular formula C32H56O8Si and a molecular weight of 596.88 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-2,4-dimethoxy-6-[(2S,3S)-2-methoxy-3-(methoxymethoxy)pent-4-enyl]-2-(2-methyl-1-phenylmethoxypropan-2-yl)oxan-3-yl]oxy-triethylsilane.
| Compound Name | [(2S,3S,4S,6R)-2,4-dimethoxy-6-[(2S,3S)-2-methoxy-3-(methoxymethoxy)pent-4-enyl]-2-(2-methyl-1-phenylmethoxypropan-2-yl)oxan-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11180919 |
| Molecular Formula | C32H56O8Si |
| Molecular Weight | 596.88 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | [(2S,3S,4S,6R)-2,4-dimethoxy-6-[(2S,3S)-2-methoxy-3-(methoxymethoxy)pent-4-enyl]-2-(2-methyl-1-phenylmethoxypropan-2-yl)oxan-3-yl]oxy-triethylsilane |
| SMILES | C=C[C@H](OCOC)[C@H](C[C@@H]1C[C@H](OC)[C@H](O[Si](CC)(CC)CC)[C@](OC)(C(C)(C)COCc2ccccc2)O1)OC |
| InChI | InChI=1S/C32H56O8Si/c1-11-27(38-24-33-7)28(34-8)20-26-21-29(35-9)30(40-41(12-2,13-3)14-4)32(36-10,39-26)31(5,6)23-37-22-25-18-16-15-17-19-25/h11,15-19,26-30H,1,12-14,20-24H2,2-10H3/t26-,27+,28+,29+,30+,32-/m1/s1 |
| InChIKey | YFRHSFWHNWWOOD-OGPIIRECSA-N |
| XLogP | 6.35 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.88 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|