C15H24F2N4 — CID 111814372
2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1,1-diethylguanidine (PubChem CID 111814372) has the molecular formula C15H24F2N4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1,1-diethylguanidine.
| Compound Name | 2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111814372 |
| Molecular Formula | C15H24F2N4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CC(c1c(F)cccc1F)N(C)C |
| InChI | InChI=1S/C15H24F2N4/c1-5-21(6-2)15(18)19-10-13(20(3)4)14-11(16)8-7-9-12(14)17/h7-9,13H,5-6,10H2,1-4H3,(H2,18,19) |
| InChIKey | QPRAIZUPUWUQKL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|