C22H26FN5O2 — CID 111819046
4-(4-fluorophenyl)-N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111819046) has the molecular formula C22H26FN5O2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111819046 |
| Molecular Formula | C22H26FN5O2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCCN1C(=O)COc2ccccc21)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26FN5O2/c23-17-6-8-18(9-7-17)26-12-14-27(15-13-26)22(24)25-10-3-11-28-19-4-1-2-5-20(19)30-16-21(28)29/h1-2,4-9H,3,10-16H2,(H2,24,25) |
| InChIKey | YWHUEBDRWWNLTK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|