C18H20N4O2 — CID 111465146
2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-1-phenylguanidine (PubChem CID 111465146) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-1-phenylguanidine.
| Compound Name | 2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 111465146 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-1-phenylguanidine |
| SMILES | N/C(=N\CCCN1C(=O)COc2ccccc21)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N4O2/c19-18(21-14-7-2-1-3-8-14)20-11-6-12-22-15-9-4-5-10-16(15)24-13-17(22)23/h1-5,7-10H,6,11-13H2,(H3,19,20,21) |
| InChIKey | ZPWAZFIWRDKEHD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|