C8H15NO4 — CID 11183096
(1S,4R,5S,6S,8S)-8-(hydroxymethyl)-2-azabicyclo[2.2.2]octane-4,5,6-triol (PubChem CID 11183096) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (1S,4R,5S,6S,8S)-8-(hydroxymethyl)-2-azabicyclo[2.2.2]octane-4,5,6-triol.
| Compound Name | (1S,4R,5S,6S,8S)-8-(hydroxymethyl)-2-azabicyclo[2.2.2]octane-4,5,6-triol |
|---|---|
| PubChem CID | 11183096 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (1S,4R,5S,6S,8S)-8-(hydroxymethyl)-2-azabicyclo[2.2.2]octane-4,5,6-triol |
| SMILES | OC[C@@H]1C[C@@H]2NC[C@@]1(O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C8H15NO4/c10-2-4-1-5-6(11)7(12)8(4,13)3-9-5/h4-7,9-13H,1-3H2/t4-,5-,6-,7-,8-/m0/s1 |
| InChIKey | KVZFAJCKXADJGT-WXUMCUSRSA-N |
| XLogP | -2.58 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |