C13H26N4O4S3 — CID 111833155
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111833155) has the molecular formula C13H26N4O4S3 and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111833155 |
| Molecular Formula | C13H26N4O4S3 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)N1CCSCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26N4O4S3/c1-2-14-13(16-12-3-9-23(18,19)11-12)15-4-10-24(20,21)17-5-7-22-8-6-17/h12H,2-11H2,1H3,(H2,14,15,16) |
| InChIKey | XHKOCEBMBGPTRZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|