C24H36N4O4 — CID 111871839
2-[(2-ethoxy-3-pyridinyl)methyl]-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111871839) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[(2-ethoxy-3-pyridinyl)methyl]-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111871839 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-[3-(2-methoxyethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CCOc1ncccc1C/N=C(\NCCCOCCOC)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C24H36N4O4/c1-5-31-23-20(8-6-13-25-23)18-27-24(26-14-7-15-30-17-16-29-4)28-21-9-11-22(12-10-21)32-19(2)3/h6,8-13,19H,5,7,14-18H2,1-4H3,(H2,26,27,28) |
| InChIKey | YVZTXJAVSACWIQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|