C23H33NO4 — CID 11188370
(2S,3S,7S,8aR)-7-[(E)-1-hydroxyhept-2-enyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11188370) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2S,3S,7S,8aR)-7-[(E)-1-hydroxyhept-2-enyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (2S,3S,7S,8aR)-7-[(E)-1-hydroxyhept-2-enyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11188370 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (2S,3S,7S,8aR)-7-[(E)-1-hydroxyhept-2-enyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CCCC/C=C/C(O)[C@@H]1CC(=O)N2[C@@H](COC)[C@H](c3ccccc3)O[C@]2(C)C1 |
| InChI | InChI=1S/C23H33NO4/c1-4-5-6-10-13-20(25)18-14-21(26)24-19(16-27-3)22(28-23(24,2)15-18)17-11-8-7-9-12-17/h7-13,18-20,22,25H,4-6,14-16H2,1-3H3/b13-10+/t18-,19+,20?,22+,23-/m1/s1 |
| InChIKey | KAYVZXHITNLPRJ-GCYGOIGKSA-N |
| XLogP | 3.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|