C21H32N6O2S — CID 111904815
1-ethyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111904815) has the molecular formula C21H32N6O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-ethyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111904815 |
| Molecular Formula | C21H32N6O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-ethyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccc(S(=O)(=O)N2CCCCC2)c1)NCCCn1cccn1 |
| InChI | InChI=1S/C21H32N6O2S/c1-2-22-21(23-11-7-13-26-14-8-12-25-26)24-18-19-9-6-10-20(17-19)30(28,29)27-15-4-3-5-16-27/h6,8-10,12,14,17H,2-5,7,11,13,15-16,18H2,1H3,(H2,22,23,24) |
| InChIKey | YCINAUJZQHVDID-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|