C27H39NO7 — CID 11191020
[(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-5-oxopent-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate (PubChem CID 11191020) has the molecular formula C27H39NO7 and a molecular weight of 489.61 g/mol. Its IUPAC name is [(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-5-oxopent-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate.
| Compound Name | [(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-5-oxopent-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate |
|---|---|
| PubChem CID | 11191020 |
| Molecular Formula | C27H39NO7 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | [(4E,6E,12E,18E)-11,14-dihydroxy-4-methyl-2-[(E)-4-methyl-5-oxopent-3-en-2-yl]-20-oxo-1-oxacycloicosa-4,6,12,18-tetraen-10-yl] carbamate |
| SMILES | C/C(C=O)=C\C(C)C1C/C(C)=C/C=C/CCC(OC(N)=O)C(O)/C=C/C(O)CCC/C=C/C(=O)O1 |
| InChI | InChI=1S/C27H39NO7/c1-19-10-6-4-8-12-24(35-27(28)33)23(31)15-14-22(30)11-7-5-9-13-26(32)34-25(17-19)21(3)16-20(2)18-29/h4,6,9-10,13-16,18,21-25,30-31H,5,7-8,11-12,17H2,1-3H3,(H2,28,33)/b6-4+,13-9+,15-14+,19-10+,20-16+ |
| InChIKey | XKGDMUIDORFBTK-JBLWTFTASA-N |
| XLogP | 3.83 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|