C9H10Br2O3 — CID 11198158
3,6-dibromo-4-(ethoxymethyl)benzene-1,2-diol (PubChem CID 11198158) has the molecular formula C9H10Br2O3 and a molecular weight of 325.98 g/mol. Its IUPAC name is 3,6-dibromo-4-(ethoxymethyl)benzene-1,2-diol.
| Compound Name | 3,6-dibromo-4-(ethoxymethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 11198158 |
| Molecular Formula | C9H10Br2O3 |
| Molecular Weight | 325.98 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | 3,6-dibromo-4-(ethoxymethyl)benzene-1,2-diol |
| SMILES | CCOCc1cc(Br)c(O)c(O)c1Br |
| InChI | InChI=1S/C9H10Br2O3/c1-2-14-4-5-3-6(10)8(12)9(13)7(5)11/h3,12-13H,2,4H2,1H3 |
| InChIKey | VMBLTZAYZFEFDT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.98 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|