C23H30IN3O4 — CID 111989592
1-(1-benzofuran-2-ylmethyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111989592) has the molecular formula C23H30IN3O4 and a molecular weight of 539.41 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111989592 |
| Molecular Formula | C23H30IN3O4 |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)N(C)Cc1cc2ccccc2o1.I |
| InChI | InChI=1S/C23H29N3O4.HI/c1-5-24-23(26(2)15-18-12-16-8-6-7-9-21(16)30-18)25-14-20(27)19-13-17(28-3)10-11-22(19)29-4;/h6-13,20,27H,5,14-15H2,1-4H3,(H,24,25);1H |
| InChIKey | YHBAEKXNYSVLKB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|