C22H27F3N4O2 — CID 111990147
2-[3-[[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111990147) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 2-[3-[[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111990147 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[3-[[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | C/N=C(/NCCC(C)c1cccc(C(F)(F)F)c1)NCc1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C22H27F3N4O2/c1-15(17-6-4-7-18(12-17)22(23,24)25)9-10-28-21(27-2)29-13-16-5-3-8-19(11-16)31-14-20(26)30/h3-8,11-12,15H,9-10,13-14H2,1-2H3,(H2,26,30)(H2,27,28,29) |
| InChIKey | OEFIIULLQMWJQU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|