C20H40Si4 — CID 11200203
trimethyl-[3-trimethylsilyl-4-(2-trimethylsilylethynyl)-5-(trimethylsilylmethyl)cyclopenta-1,4-dien-1-yl]silane (PubChem CID 11200203) has the molecular formula C20H40Si4 and a molecular weight of 392.88 g/mol. Its IUPAC name is trimethyl-[3-trimethylsilyl-4-(2-trimethylsilylethynyl)-5-(trimethylsilylmethyl)cyclopenta-1,4-dien-1-yl]silane.
| Compound Name | trimethyl-[3-trimethylsilyl-4-(2-trimethylsilylethynyl)-5-(trimethylsilylmethyl)cyclopenta-1,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 11200203 |
| Molecular Formula | C20H40Si4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | trimethyl-[3-trimethylsilyl-4-(2-trimethylsilylethynyl)-5-(trimethylsilylmethyl)cyclopenta-1,4-dien-1-yl]silane |
| SMILES | C[Si](C)(C)C#CC1=C(C[Si](C)(C)C)C([Si](C)(C)C)=CC1[Si](C)(C)C |
| InChI | InChI=1S/C20H40Si4/c1-21(2,3)14-13-17-18(16-22(4,5)6)20(24(10,11)12)15-19(17)23(7,8)9/h15,19H,16H2,1-12H3 |
| InChIKey | WWWNHJIMKOOFSD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|