C22H40Si2 — CID 552286
9-(3,3-dimethyl-2-trimethylsilylcyclopenta-1,4-dien-1-yl)non-1-ynyl-trimethylsilane (PubChem CID 552286) has the molecular formula C22H40Si2 and a molecular weight of 360.73 g/mol. Its IUPAC name is 9-(3,3-dimethyl-2-trimethylsilylcyclopenta-1,4-dien-1-yl)non-1-ynyl-trimethylsilane.
| Compound Name | 9-(3,3-dimethyl-2-trimethylsilylcyclopenta-1,4-dien-1-yl)non-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 552286 |
| Molecular Formula | C22H40Si2 |
| Molecular Weight | 360.73 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 9-(3,3-dimethyl-2-trimethylsilylcyclopenta-1,4-dien-1-yl)non-1-ynyl-trimethylsilane |
| SMILES | CC1(C)C=CC(CCCCCCCC#C[Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C22H40Si2/c1-22(2)18-17-20(21(22)24(6,7)8)16-14-12-10-9-11-13-15-19-23(3,4)5/h17-18H,9-14,16H2,1-8H3 |
| InChIKey | DLIXZEMSZOQOCU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.73 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|