C27H50Si — CID 134941907
tri(propan-2-yl)-[(3Z,5E)-3,4,5-tripropylnona-3,5-dien-1-ynyl]silane (PubChem CID 134941907) has the molecular formula C27H50Si and a molecular weight of 402.78 g/mol. Its IUPAC name is tri(propan-2-yl)-[(3Z,5E)-3,4,5-tripropylnona-3,5-dien-1-ynyl]silane.
| Compound Name | tri(propan-2-yl)-[(3Z,5E)-3,4,5-tripropylnona-3,5-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 134941907 |
| Molecular Formula | C27H50Si |
| Molecular Weight | 402.78 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | tri(propan-2-yl)-[(3Z,5E)-3,4,5-tripropylnona-3,5-dien-1-ynyl]silane |
| SMILES | CCC/C=C(CCC)/C(CCC)=C(\C#C[Si](C(C)C)(C(C)C)C(C)C)CCC |
| InChI | InChI=1S/C27H50Si/c1-11-15-19-25(16-12-2)27(18-14-4)26(17-13-3)20-21-28(22(5)6,23(7)8)24(9)10/h19,22-24H,11-18H2,1-10H3/b25-19+,27-26- |
| InChIKey | QYEKFWZABHTFEY-LZOXUMOWSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.78 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|