C16H16O6 — CID 11208908
(2R)-6,8-dihydroxy-7-methoxy-2,3,3-trimethyl-2H-benzo[f][1]benzofuran-4,9-dione (PubChem CID 11208908) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (2R)-6,8-dihydroxy-7-methoxy-2,3,3-trimethyl-2H-benzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2R)-6,8-dihydroxy-7-methoxy-2,3,3-trimethyl-2H-benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 11208908 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (2R)-6,8-dihydroxy-7-methoxy-2,3,3-trimethyl-2H-benzo[f][1]benzofuran-4,9-dione |
| SMILES | COc1c(O)cc2c(c1O)C(=O)C1=C(C2=O)C(C)(C)[C@@H](C)O1 |
| InChI | InChI=1S/C16H16O6/c1-6-16(2,3)10-11(18)7-5-8(17)14(21-4)12(19)9(7)13(20)15(10)22-6/h5-6,17,19H,1-4H3/t6-/m1/s1 |
| InChIKey | NMWOPEGXVGPYLC-ZCFIWIBFSA-N |
| XLogP | 2.18 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|