C21H16N2O6 — CID 139589415
2-(5,7-dihydroxy-6-methoxy-3-methyl-4,9-dioxobenzo[f]isoindol-2-yl)benzamide (PubChem CID 139589415) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-(5,7-dihydroxy-6-methoxy-3-methyl-4,9-dioxobenzo[f]isoindol-2-yl)benzamide.
| Compound Name | 2-(5,7-dihydroxy-6-methoxy-3-methyl-4,9-dioxobenzo[f]isoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 139589415 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(5,7-dihydroxy-6-methoxy-3-methyl-4,9-dioxobenzo[f]isoindol-2-yl)benzamide |
| SMILES | COc1c(O)cc2c(c1O)C(=O)c1c(cn(-c3ccccc3C(N)=O)c1C)C2=O |
| InChI | InChI=1S/C21H16N2O6/c1-9-15-12(8-23(9)13-6-4-3-5-10(13)21(22)28)17(25)11-7-14(24)20(29-2)19(27)16(11)18(15)26/h3-8,24,27H,1-2H3,(H2,22,28) |
| InChIKey | STNSNJGXPASRKT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|