C19H18N2O4S — CID 11210911
(2R,4R,7S,9R)-7-methyl-8-(4-methylphenyl)sulfonyl-3-oxa-5,8-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(14),10,12-trien-6-one (PubChem CID 11210911) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is (2R,4R,7S,9R)-7-methyl-8-(4-methylphenyl)sulfonyl-3-oxa-5,8-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(14),10,12-trien-6-one.
| Compound Name | (2R,4R,7S,9R)-7-methyl-8-(4-methylphenyl)sulfonyl-3-oxa-5,8-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(14),10,12-trien-6-one |
|---|---|
| PubChem CID | 11210911 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2R,4R,7S,9R)-7-methyl-8-(4-methylphenyl)sulfonyl-3-oxa-5,8-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(14),10,12-trien-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3c4ccccc4[C@H]4O[C@H]4N3C(=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-11-7-9-13(10-8-11)26(23,24)21-12(2)18(22)20-17(21)15-6-4-3-5-14(15)16-19(20)25-16/h3-10,12,16-17,19H,1-2H3/t12-,16+,17+,19+/m0/s1 |
| InChIKey | QEJQSKQVOYPQQQ-ZHCSWWCTSA-N |
| XLogP | 2.33 |
| TPSA | 70.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|