C14H10O3 — CID 11218392
3-hydroxy-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclobut-3-ene-1,2-dione (PubChem CID 11218392) has the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-hydroxy-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-hydroxy-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11218392 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-hydroxy-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(O)c(/C=C/C=C/c2ccccc2)c1=O |
| InChI | InChI=1S/C14H10O3/c15-12-11(13(16)14(12)17)9-5-4-8-10-6-2-1-3-7-10/h1-9,15H/b8-4+,9-5+ |
| InChIKey | AHGNABBEUICVGW-KBXRYBNXSA-N |
| XLogP | 1.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|