C22H13F5N2O — CID 11223775
2,3-difluoro-N-[4-[1-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide (PubChem CID 11223775) has the molecular formula C22H13F5N2O and a molecular weight of 416.35 g/mol. Its IUPAC name is 2,3-difluoro-N-[4-[1-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide.
| Compound Name | 2,3-difluoro-N-[4-[1-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 11223775 |
| Molecular Formula | C22H13F5N2O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2,3-difluoro-N-[4-[1-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2cc(C(F)(F)F)c3ccccn23)cc1)c1cccc(F)c1F |
| InChI | InChI=1S/C22H13F5N2O/c23-17-5-3-4-15(20(17)24)21(30)28-14-9-7-13(8-10-14)19-12-16(22(25,26)27)18-6-1-2-11-29(18)19/h1-12H,(H,28,30) |
| InChIKey | QFWIGGCFWBPYRD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 33.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |