About [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate
[3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate (PubChem CID 67534038) has the molecular formula C24H15F5N2O4
and a molecular weight of 490.38 g/mol. Its IUPAC name is [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate.
Molecular Properties
| Compound Name | [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate |
| PubChem CID | 67534038 |
| Molecular Formula | C24H15F5N2O4 |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc2cc(C(F)(F)F)c(-c3ccc(NC(=O)c4cccc(F)c4F)cc3)n2c1 |
| InChI | InChI=1S/C24H15F5N2O4/c1-34-23(33)35-16-10-9-15-11-18(24(27,28)29)21(31(15)12-16)13-5-7-14(8-6-13)30-22(32)17-3-2-4-19(25)20(17)26/h2-12H,1H3,(H,30,32) |
| InChIKey | DFGYJMPHOXUDKB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate?
The IUPAC name of [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate (CID 67534038) is [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate.
What is the SMILES notation for [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate?
The canonical SMILES for [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate is COC(=O)Oc1ccc2cc(C(F)(F)F)c(-c3ccc(NC(=O)c4cccc(F)c4F)cc3)n2c1.
What is the InChIKey of [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate?
The InChIKey is DFGYJMPHOXUDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15F5N2O4/c1-34-23(33)35-16-10-9-15-11-18(24(27,28)29)21(31(15)12-16)13-5-7-14(8-6-13)30-22(32)17-3-2-4-19(25)20(17)26/h2-12H,1H3,(H,30,32).
What are the key properties of [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate?
[3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate has a molecular weight of 490.38 g/mol, XLogP of 6.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-[(2,3-difluorobenzoyl)amino]phenyl]-2-(trifluoromethyl)indolizin-6-yl] methyl carbonate is sourced from PubChem (CID 67534038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).