C20H14ClF5N2O — CID 142993996
N-[4-[1-(chloromethyl)-5-methyl-3-(trifluoromethyl)pyrrol-2-yl]phenyl]-2,6-difluorobenzamide (PubChem CID 142993996) has the molecular formula C20H14ClF5N2O and a molecular weight of 428.79 g/mol. Its IUPAC name is N-[4-[1-(chloromethyl)-5-methyl-3-(trifluoromethyl)pyrrol-2-yl]phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[4-[1-(chloromethyl)-5-methyl-3-(trifluoromethyl)pyrrol-2-yl]phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 142993996 |
| Molecular Formula | C20H14ClF5N2O |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-[4-[1-(chloromethyl)-5-methyl-3-(trifluoromethyl)pyrrol-2-yl]phenyl]-2,6-difluorobenzamide |
| SMILES | Cc1cc(C(F)(F)F)c(-c2ccc(NC(=O)c3c(F)cccc3F)cc2)n1CCl |
| InChI | InChI=1S/C20H14ClF5N2O/c1-11-9-14(20(24,25)26)18(28(11)10-21)12-5-7-13(8-6-12)27-19(29)17-15(22)3-2-4-16(17)23/h2-9H,10H2,1H3,(H,27,29) |
| InChIKey | JKQJKMBVIKCDKH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|