C22H12F6N2O — CID 11487330
2,3-difluoro-N-[4-[5-fluoro-2-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide (PubChem CID 11487330) has the molecular formula C22H12F6N2O and a molecular weight of 434.34 g/mol. Its IUPAC name is 2,3-difluoro-N-[4-[5-fluoro-2-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide.
| Compound Name | 2,3-difluoro-N-[4-[5-fluoro-2-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 11487330 |
| Molecular Formula | C22H12F6N2O |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2,3-difluoro-N-[4-[5-fluoro-2-(trifluoromethyl)indolizin-3-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2c(C(F)(F)F)cc3cccc(F)n23)cc1)c1cccc(F)c1F |
| InChI | InChI=1S/C22H12F6N2O/c23-17-5-2-4-15(19(17)25)21(31)29-13-9-7-12(8-10-13)20-16(22(26,27)28)11-14-3-1-6-18(24)30(14)20/h1-11H,(H,29,31) |
| InChIKey | QFGFRYFWZRGBQP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 33.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|