C30H27NO4 — CID 11225079
(2Z)-6-[3-[(3-hydroxyphenyl)methyl-methylamino]propoxy]-2-(naphthalen-1-ylmethylidene)-1-benzofuran-3-one (PubChem CID 11225079) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is (2Z)-6-[3-[(3-hydroxyphenyl)methyl-methylamino]propoxy]-2-(naphthalen-1-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[3-[(3-hydroxyphenyl)methyl-methylamino]propoxy]-2-(naphthalen-1-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 11225079 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (2Z)-6-[3-[(3-hydroxyphenyl)methyl-methylamino]propoxy]-2-(naphthalen-1-ylmethylidene)-1-benzofuran-3-one |
| SMILES | CN(CCCOc1ccc2c(c1)O/C(=C\c1cccc3ccccc13)C2=O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C30H27NO4/c1-31(20-21-7-4-11-24(32)17-21)15-6-16-34-25-13-14-27-28(19-25)35-29(30(27)33)18-23-10-5-9-22-8-2-3-12-26(22)23/h2-5,7-14,17-19,32H,6,15-16,20H2,1H3/b29-18- |
| InChIKey | YIIOJCRISCKPQN-MIXAMLLLSA-N |
| XLogP | 6.06 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|